C26H56O2Si2 — CID 10027087
trimethyl-[(E,1R,4S)-1-nonyl-4-trimethylsilyloxyundec-2-enoxy]silane (PubChem CID 10027087) has the molecular formula C26H56O2Si2 and a molecular weight of 456.90 g/mol. Its IUPAC name is trimethyl-[(E,1R,4S)-1-nonyl-4-trimethylsilyloxyundec-2-enoxy]silane.
| Compound Name | trimethyl-[(E,1R,4S)-1-nonyl-4-trimethylsilyloxyundec-2-enoxy]silane |
|---|---|
| PubChem CID | 10027087 |
| Molecular Formula | C26H56O2Si2 |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | trimethyl-[(E,1R,4S)-1-nonyl-4-trimethylsilyloxyundec-2-enoxy]silane |
| SMILES | CCCCCCCCC[C@H](/C=C/[C@H](CCCCCCC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H56O2Si2/c1-9-11-13-15-16-18-20-22-26(28-30(6,7)8)24-23-25(27-29(3,4)5)21-19-17-14-12-10-2/h23-26H,9-22H2,1-8H3/b24-23+/t25-,26+/m0/s1 |
| InChIKey | QJPFXPWBARWNSS-ZIJUKQBZSA-N |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|