C36H76O2SiSn2 — CID 177475405
(1E,3S,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-bis(tributylstannyl)hexa-1,5-dien-3-ol (PubChem CID 177475405) has the molecular formula C36H76O2SiSn2 and a molecular weight of 806.51 g/mol. Its IUPAC name is (1E,3S,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-bis(tributylstannyl)hexa-1,5-dien-3-ol.
| Compound Name | (1E,3S,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-bis(tributylstannyl)hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 177475405 |
| Molecular Formula | C36H76O2SiSn2 |
| Molecular Weight | 806.51 g/mol |
| Exact Mass | 808.37 |
| IUPAC Name | (1E,3S,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1,6-bis(tributylstannyl)hexa-1,5-dien-3-ol |
| SMILES | CCCC[Sn](/C=C/[C@H](O)[C@@H](/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C12H22O2Si.6C4H9.2Sn/c1-8-10(13)11(9-2)14-15(6,7)12(3,4)5;6*1-3-4-2;;/h1-2,8-11,13H,3-7H3;6*1,3-4H2,2H3;;/t10-,11+;;;;;;;;/m0......../s1 |
| InChIKey | PIYBVOWALQKRDM-CTBRWSDOSA-N |
| XLogP | 12.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.51 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|