C37H82O3Si3Sn — CID 10700411
[(1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(E)-2-tributylstannylethenyl]pentoxy]-tert-butyl-dimethylsilane (PubChem CID 10700411) has the molecular formula C37H82O3Si3Sn and a molecular weight of 778.03 g/mol. Its IUPAC name is [(1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(E)-2-tributylstannylethenyl]pentoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(E)-2-tributylstannylethenyl]pentoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10700411 |
| Molecular Formula | C37H82O3Si3Sn |
| Molecular Weight | 778.03 g/mol |
| Exact Mass | 778.46 |
| IUPAC Name | [(1R,2S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(E)-2-tributylstannylethenyl]pentoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C25H55O3Si3.3C4H9.Sn/c1-17-21(27-30(13,14)24(5,6)7)22(28-31(15,16)25(8,9)10)19-18-20-26-29(11,12)23(2,3)4;3*1-3-4-2;/h1,17,21-22H,18-20H2,2-16H3;3*1,3-4H2,2H3;/t21-,22+;;;;/m1..../s1 |
| InChIKey | BWJSTOVBRDYELD-BVDNDJHXSA-N |
| XLogP | 13.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.03 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|