C24H52O2SiSn — CID 10815797
(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-tributylstannylhex-2-en-1-ol (PubChem CID 10815797) has the molecular formula C24H52O2SiSn and a molecular weight of 519.48 g/mol. Its IUPAC name is (E)-6-[tert-butyl(dimethyl)silyl]oxy-1-tributylstannylhex-2-en-1-ol.
| Compound Name | (E)-6-[tert-butyl(dimethyl)silyl]oxy-1-tributylstannylhex-2-en-1-ol |
|---|---|
| PubChem CID | 10815797 |
| Molecular Formula | C24H52O2SiSn |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (E)-6-[tert-butyl(dimethyl)silyl]oxy-1-tributylstannylhex-2-en-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(O)/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25O2Si.3C4H9.Sn/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13;3*1-3-4-2;/h6,8,10,13H,7,9,11H2,1-5H3;3*1,3-4H2,2H3;/b8-6+;;;; |
| InChIKey | GYQMOCFPAZQTDT-UFCFYSFLSA-N |
| XLogP | 8.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|