C28H56O2Si — CID 125481290
(4S,13Z,16Z)-1-[tert-butyl(dimethyl)silyl]oxydocosa-13,16-dien-4-ol (PubChem CID 125481290) has the molecular formula C28H56O2Si and a molecular weight of 452.84 g/mol. Its IUPAC name is (4S,13Z,16Z)-1-[tert-butyl(dimethyl)silyl]oxydocosa-13,16-dien-4-ol.
| Compound Name | (4S,13Z,16Z)-1-[tert-butyl(dimethyl)silyl]oxydocosa-13,16-dien-4-ol |
|---|---|
| PubChem CID | 125481290 |
| Molecular Formula | C28H56O2Si |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.40 |
| IUPAC Name | (4S,13Z,16Z)-1-[tert-butyl(dimethyl)silyl]oxydocosa-13,16-dien-4-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC[C@H](O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-27(29)25-23-26-30-31(5,6)28(2,3)4/h11-12,14-15,27,29H,7-10,13,16-26H2,1-6H3/b12-11-,15-14-/t27-/m0/s1 |
| InChIKey | XQAAAHWMPUZYCS-FKJBPEEJSA-N |
| XLogP | 9.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|