About tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane
tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane (PubChem CID 59708132) has the molecular formula C18H36F2OSi
and a molecular weight of 334.57 g/mol. Its IUPAC name is tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane |
| PubChem CID | 59708132 |
| Molecular Formula | C18H36F2OSi |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/CCCCCCC(F)F |
| InChI | InChI=1S/C18H36F2OSi/c1-18(2,3)22(4,5)21-16-14-12-10-8-6-7-9-11-13-15-17(19)20/h8,10,17H,6-7,9,11-16H2,1-5H3/b10-8+ |
| InChIKey | BWBKYEUADWAGLA-CSKARUKUSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane (CID 59708132) is tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane is CC(C)(C)[Si](C)(C)OCCC/C=C/CCCCCCC(F)F.
What is the InChIKey of tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane?
The InChIKey is BWBKYEUADWAGLA-CSKARUKUSA-N. The full InChI is InChI=1S/C18H36F2OSi/c1-18(2,3)22(4,5)21-16-14-12-10-8-6-7-9-11-13-15-17(19)20/h8,10,17H,6-7,9,11-16H2,1-5H3/b10-8+.
What are the key properties of tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane?
tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane has a molecular weight of 334.57 g/mol, XLogP of 6.95, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E)-12,12-difluorododec-4-enoxy]-dimethylsilane is sourced from PubChem (CID 59708132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).