C18H36O2Si — CID 11197758
tert-butyl-[(5Z,9Z)-10-ethoxydeca-5,9-dienoxy]-dimethylsilane (PubChem CID 11197758) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-[(5Z,9Z)-10-ethoxydeca-5,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5Z,9Z)-10-ethoxydeca-5,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11197758 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl-[(5Z,9Z)-10-ethoxydeca-5,9-dienoxy]-dimethylsilane |
| SMILES | CCO/C=C\CC/C=C\CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-7-19-16-14-12-10-8-9-11-13-15-17-20-21(5,6)18(2,3)4/h8-9,14,16H,7,10-13,15,17H2,1-6H3/b9-8-,16-14- |
| InChIKey | BLKFRBRWJYYMTH-CXRYTTAVSA-N |
| XLogP | 6.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|