C22H44OSi — CID 11371613
tert-butyl-[(10E,12Z)-hexadeca-10,12-dienoxy]-dimethylsilane (PubChem CID 11371613) has the molecular formula C22H44OSi and a molecular weight of 352.68 g/mol. Its IUPAC name is tert-butyl-[(10E,12Z)-hexadeca-10,12-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(10E,12Z)-hexadeca-10,12-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11371613 |
| Molecular Formula | C22H44OSi |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | tert-butyl-[(10E,12Z)-hexadeca-10,12-dienoxy]-dimethylsilane |
| SMILES | CCC/C=C\C=C\CCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44OSi/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(5,6)22(2,3)4/h9-12H,7-8,13-21H2,1-6H3/b10-9-,12-11+ |
| InChIKey | VAADGADXRMNEBA-XAZJVICWSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|