C18H34O2Si — CID 10543017
(5E,7E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-dienal (PubChem CID 10543017) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (5E,7E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-dienal.
| Compound Name | (5E,7E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-dienal |
|---|---|
| PubChem CID | 10543017 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (5E,7E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-dienal |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C=C/C=C/CCCC=O |
| InChI | InChI=1S/C18H34O2Si/c1-18(2,3)21(4,5)20-17-15-13-11-9-7-6-8-10-12-14-16-19/h6-9,16H,10-15,17H2,1-5H3/b8-6+,9-7+ |
| InChIKey | PCAZPTGQURSHBB-CDJQDVQCSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|