C12H24O2Si — CID 11310746
(E)-6-[tert-butyl(dimethyl)silyl]oxyhex-2-enal (PubChem CID 11310746) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (E)-6-[tert-butyl(dimethyl)silyl]oxyhex-2-enal.
| Compound Name | (E)-6-[tert-butyl(dimethyl)silyl]oxyhex-2-enal |
|---|---|
| PubChem CID | 11310746 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (E)-6-[tert-butyl(dimethyl)silyl]oxyhex-2-enal |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/C=O |
| InChI | InChI=1S/C12H24O2Si/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13/h6,8,10H,7,9,11H2,1-5H3/b8-6+ |
| InChIKey | DLAVNOLVLNHAMB-SOFGYWHQSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|