C16H30OSi — CID 134860974
tert-butyl-[(4E,6E,8E)-deca-4,6,8-trienoxy]-dimethylsilane (PubChem CID 134860974) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is tert-butyl-[(4E,6E,8E)-deca-4,6,8-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4E,6E,8E)-deca-4,6,8-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134860974 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | tert-butyl-[(4E,6E,8E)-deca-4,6,8-trienoxy]-dimethylsilane |
| SMILES | C/C=C/C=C/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30OSi/c1-7-8-9-10-11-12-13-14-15-17-18(5,6)16(2,3)4/h7-12H,13-15H2,1-6H3/b8-7+,10-9+,12-11+ |
| InChIKey | JZXVXJAVUIMAOP-SNUJAXHWSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|