C19H36OSi — CID 11312882
tert-butyl-dimethyl-[(4R,6E,8E,10E)-4-methyldodeca-6,8,10-trienoxy]silane (PubChem CID 11312882) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R,6E,8E,10E)-4-methyldodeca-6,8,10-trienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4R,6E,8E,10E)-4-methyldodeca-6,8,10-trienoxy]silane |
|---|---|
| PubChem CID | 11312882 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl-dimethyl-[(4R,6E,8E,10E)-4-methyldodeca-6,8,10-trienoxy]silane |
| SMILES | C/C=C/C=C/C=C/C[C@H](C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi/c1-8-9-10-11-12-13-15-18(2)16-14-17-20-21(6,7)19(3,4)5/h8-13,18H,14-17H2,1-7H3/b9-8+,11-10+,13-12+/t18-/m0/s1 |
| InChIKey | PYNLSJQGTXADGJ-DIXOBBMRSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|