C17H34O3Si — CID 87313123
(E)-11-[tert-butyl(dimethyl)silyl]oxyundec-2-enoic acid (PubChem CID 87313123) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (E)-11-[tert-butyl(dimethyl)silyl]oxyundec-2-enoic acid.
| Compound Name | (E)-11-[tert-butyl(dimethyl)silyl]oxyundec-2-enoic acid |
|---|---|
| PubChem CID | 87313123 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (E)-11-[tert-butyl(dimethyl)silyl]oxyundec-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C17H34O3Si/c1-17(2,3)21(4,5)20-15-13-11-9-7-6-8-10-12-14-16(18)19/h12,14H,6-11,13,15H2,1-5H3,(H,18,19)/b14-12+ |
| InChIKey | DCUKTQWMFWAPSM-WYMLVPIESA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|