C10H20O3Si — CID 85272131
4-[tert-butyl(dimethyl)silyl]oxybut-2-enoic acid (PubChem CID 85272131) has the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxybut-2-enoic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 85272131 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxybut-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC=CC(=O)O |
| InChI | InChI=1S/C10H20O3Si/c1-10(2,3)14(4,5)13-8-6-7-9(11)12/h6-7H,8H2,1-5H3,(H,11,12) |
| InChIKey | NJYVQYNUSUTVOJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|