C17H25NO3Si — CID 11324648
N-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enoyl]benzamide (PubChem CID 11324648) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is N-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enoyl]benzamide.
| Compound Name | N-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enoyl]benzamide |
|---|---|
| PubChem CID | 11324648 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enoyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3Si/c1-17(2,3)22(4,5)21-13-9-12-15(19)18-16(20)14-10-7-6-8-11-14/h6-12H,13H2,1-5H3,(H,18,19,20)/b12-9+ |
| InChIKey | WRZXLNYMRBEJAQ-FMIVXFBMSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|