C24H34O3Si — CID 46854924
[(7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-yl] benzoate (PubChem CID 46854924) has the molecular formula C24H34O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is [(7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-yl] benzoate.
| Compound Name | [(7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-yl] benzoate |
|---|---|
| PubChem CID | 46854924 |
| Molecular Formula | C24H34O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-yl] benzoate |
| SMILES | CC(C)=CC(C#C/C(C)=C\CO[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34O3Si/c1-19(2)18-22(27-23(25)21-12-10-9-11-13-21)15-14-20(3)16-17-26-28(7,8)24(4,5)6/h9-13,16,18,22H,17H2,1-8H3/b20-16- |
| InChIKey | YJXANBVZEXUMFC-SILNSSARSA-N |
| XLogP | 6.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|