C18H24O3Si — CID 135028614
6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-3-yne-1,2-dione (PubChem CID 135028614) has the molecular formula C18H24O3Si and a molecular weight of 316.47 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-3-yne-1,2-dione.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-3-yne-1,2-dione |
|---|---|
| PubChem CID | 135028614 |
| Molecular Formula | C18H24O3Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-3-yne-1,2-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#CC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O3Si/c1-18(2,3)22(4,5)21-14-10-9-13-16(19)17(20)15-11-7-6-8-12-15/h6-8,11-12H,10,14H2,1-5H3 |
| InChIKey | RYNVXQGVTODQJT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'} |
|---|