C18H29NO2Si — CID 154719744
N-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]benzamide (PubChem CID 154719744) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is N-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]benzamide.
| Compound Name | N-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]benzamide |
|---|---|
| PubChem CID | 154719744 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C\NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2Si/c1-18(2,3)22(4,5)21-15-11-7-10-14-19-17(20)16-12-8-6-9-13-16/h6,8-10,12-14H,7,11,15H2,1-5H3,(H,19,20)/b14-10- |
| InChIKey | MMHCICKKXBEBIO-UVTDQMKNSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|