C22H38N2O2Si — CID 85242696
N'-[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclopentyl]benzohydrazide (PubChem CID 85242696) has the molecular formula C22H38N2O2Si and a molecular weight of 390.64 g/mol. Its IUPAC name is N'-[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclopentyl]benzohydrazide.
| Compound Name | N'-[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclopentyl]benzohydrazide |
|---|---|
| PubChem CID | 85242696 |
| Molecular Formula | C22H38N2O2Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | N'-[2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclopentyl]benzohydrazide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC1CCCC1NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H38N2O2Si/c1-22(2,3)27(4,5)26-17-10-9-12-18-15-11-16-20(18)23-24-21(25)19-13-7-6-8-14-19/h6-8,13-14,18,20,23H,9-12,15-17H2,1-5H3,(H,24,25) |
| InChIKey | HHSZWGVJXZEYOB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|