C28H32N4O — CID 15468085
N'-[2-[(4E)-4-(diphenylhydrazinylidene)butyl]cyclopentyl]benzohydrazide (PubChem CID 15468085) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is N'-[2-[(4E)-4-(diphenylhydrazinylidene)butyl]cyclopentyl]benzohydrazide.
| Compound Name | N'-[2-[(4E)-4-(diphenylhydrazinylidene)butyl]cyclopentyl]benzohydrazide |
|---|---|
| PubChem CID | 15468085 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N'-[2-[(4E)-4-(diphenylhydrazinylidene)butyl]cyclopentyl]benzohydrazide |
| SMILES | O=C(NNC1CCCC1CCC/C=N/N(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O/c33-28(24-14-4-1-5-15-24)31-30-27-21-12-16-23(27)13-10-11-22-29-32(25-17-6-2-7-18-25)26-19-8-3-9-20-26/h1-9,14-15,17-20,22-23,27,30H,10-13,16,21H2,(H,31,33)/b29-22+ |
| InChIKey | BWYDYJCXJYPVQB-QUPMIFSKSA-N |
| XLogP | 6.08 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|