C28H34N4O2S — CID 10743681
N-[(E)-4-[(1S,2R)-2-(2,2-diphenylhydrazinyl)cyclopentyl]butylideneamino]-4-methylbenzenesulfonamide (PubChem CID 10743681) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[(E)-4-[(1S,2R)-2-(2,2-diphenylhydrazinyl)cyclopentyl]butylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-4-[(1S,2R)-2-(2,2-diphenylhydrazinyl)cyclopentyl]butylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10743681 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[(E)-4-[(1S,2R)-2-(2,2-diphenylhydrazinyl)cyclopentyl]butylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/CCC[C@@H]2CCC[C@H]2NN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34N4O2S/c1-23-18-20-27(21-19-23)35(33,34)31-29-22-9-8-11-24-12-10-17-28(24)30-32(25-13-4-2-5-14-25)26-15-6-3-7-16-26/h2-7,13-16,18-22,24,28,30-31H,8-12,17H2,1H3/b29-22+/t24-,28-/m1/s1 |
| InChIKey | XIJSMVBNPRBASO-YHRVQHAOSA-N |
| XLogP | 5.94 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|