C16H23NO4S — CID 95654521
3-[(1R,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanoic acid (PubChem CID 95654521) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-[(1R,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanoic acid.
| Compound Name | 3-[(1R,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 95654521 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-[(1R,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H23NO4S/c1-12-6-9-14(10-7-12)22(20,21)17-15-5-3-2-4-13(15)8-11-16(18)19/h6-7,9-10,13,15,17H,2-5,8,11H2,1H3,(H,18,19)/t13-,15+/m1/s1 |
| InChIKey | HXPLXSVAPXCMEO-HIFRSBDPSA-N |
| XLogP | 2.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |