C13H19NO2S2 — CID 25140124
4-methyl-N-[(1R,2R)-2-sulfanylcyclohexyl]benzenesulfonamide (PubChem CID 25140124) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-sulfanylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-sulfanylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25140124 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-sulfanylcyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2S)cc1 |
| InChI | InChI=1S/C13H19NO2S2/c1-10-6-8-11(9-7-10)18(15,16)14-12-4-2-3-5-13(12)17/h6-9,12-14,17H,2-5H2,1H3/t12-,13-/m1/s1 |
| InChIKey | BCFRQQVNEUBNKN-CHWSQXEVSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|