C15H23NO2S — CID 7728447
N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 7728447) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7728447 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCC[C@H](C)[C@H]2C)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-11-7-9-14(10-8-11)19(17,18)16-15-6-4-5-12(2)13(15)3/h7-10,12-13,15-16H,4-6H2,1-3H3/t12-,13+,15-/m0/s1 |
| InChIKey | GVYIJKMMUSAMBA-GUTXKFCHSA-N |
| XLogP | 3.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |