C15H21F2NO4S2 — CID 42958006
4-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclohexyl)benzenesulfonamide (PubChem CID 42958006) has the molecular formula C15H21F2NO4S2 and a molecular weight of 381.47 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42958006 |
| Molecular Formula | C15H21F2NO4S2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2ccc(S(=O)(=O)C(F)F)cc2)C1C |
| InChI | InChI=1S/C15H21F2NO4S2/c1-10-4-3-5-14(11(10)2)18-24(21,22)13-8-6-12(7-9-13)23(19,20)15(16)17/h6-11,14-15,18H,3-5H2,1-2H3 |
| InChIKey | BUMDPNBFATUOAP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |