C14H19F2NO2S — CID 11928435
N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2,6-difluorobenzenesulfonamide (PubChem CID 11928435) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 11928435 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2,6-difluorobenzenesulfonamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO2S/c1-9-5-3-8-13(10(9)2)17-20(18,19)14-11(15)6-4-7-12(14)16/h4,6-7,9-10,13,17H,3,5,8H2,1-2H3/t9-,10+,13+/m0/s1 |
| InChIKey | LRVMETGUGNLVQL-OPQQBVKSSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |