C12H15F2NO3S — CID 95984043
2,6-difluoro-N-[(1R,3R)-3-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 95984043) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 2,6-difluoro-N-[(1R,3R)-3-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[(1R,3R)-3-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95984043 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,6-difluoro-N-[(1R,3R)-3-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCC[C@@H](O)C1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2NO3S/c13-10-5-2-6-11(14)12(10)19(17,18)15-8-3-1-4-9(16)7-8/h2,5-6,8-9,15-16H,1,3-4,7H2/t8-,9-/m1/s1 |
| InChIKey | JCKOYPOHSAVSME-RKDXNWHRSA-N |
| XLogP | 1.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |