C13H18ClNO3S — CID 95984034
5-chloro-N-[(1S,3S)-3-hydroxycyclohexyl]-2-methylbenzenesulfonamide (PubChem CID 95984034) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 5-chloro-N-[(1S,3S)-3-hydroxycyclohexyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[(1S,3S)-3-hydroxycyclohexyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 95984034 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-chloro-N-[(1S,3S)-3-hydroxycyclohexyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-9-5-6-10(14)7-13(9)19(17,18)15-11-3-2-4-12(16)8-11/h5-7,11-12,15-16H,2-4,8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | REEPYZLYCHVKSX-RYUDHWBXSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |