C10H14ClNO3S2 — CID 95984008
5-chloro-N-[(1S,3R)-3-hydroxycyclohexyl]thiophene-2-sulfonamide (PubChem CID 95984008) has the molecular formula C10H14ClNO3S2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 5-chloro-N-[(1S,3R)-3-hydroxycyclohexyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(1S,3R)-3-hydroxycyclohexyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 95984008 |
| Molecular Formula | C10H14ClNO3S2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 5-chloro-N-[(1S,3R)-3-hydroxycyclohexyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCC[C@@H](O)C1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO3S2/c11-9-4-5-10(16-9)17(14,15)12-7-2-1-3-8(13)6-7/h4-5,7-8,12-13H,1-3,6H2/t7-,8+/m0/s1 |
| InChIKey | WRKJYHMDXJYSCB-JGVFFNPUSA-N |
| XLogP | 1.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |