C8H11ClN2O2S2 — CID 43597846
N-(3-aminocyclobutyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 43597846) has the molecular formula C8H11ClN2O2S2 and a molecular weight of 266.78 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43597846 |
| Molecular Formula | C8H11ClN2O2S2 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | N-(3-aminocyclobutyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | NC1CC(NS(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C8H11ClN2O2S2/c9-7-1-2-8(14-7)15(12,13)11-6-3-5(10)4-6/h1-2,5-6,11H,3-4,10H2 |
| InChIKey | KQMSBZJLWYMBAE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |