C14H18ClNO2S2 — CID 22204431
N-(2-adamantyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 22204431) has the molecular formula C14H18ClNO2S2 and a molecular weight of 331.89 g/mol. Its IUPAC name is N-(2-adamantyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(2-adamantyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22204431 |
| Molecular Formula | C14H18ClNO2S2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(2-adamantyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1C2CC3CC(C2)CC1C3)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H18ClNO2S2/c15-12-1-2-13(19-12)20(17,18)16-14-10-4-8-3-9(6-10)7-11(14)5-8/h1-2,8-11,14,16H,3-7H2 |
| InChIKey | SOWXJJRBUNHQDC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |