C19H20ClNO2S2 — CID 59701874
N-(3-benzylidene-8-bicyclo[3.2.1]octanyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 59701874) has the molecular formula C19H20ClNO2S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-(3-benzylidene-8-bicyclo[3.2.1]octanyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(3-benzylidene-8-bicyclo[3.2.1]octanyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59701874 |
| Molecular Formula | C19H20ClNO2S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(3-benzylidene-8-bicyclo[3.2.1]octanyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1C2CCC1CC(=Cc1ccccc1)C2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H20ClNO2S2/c20-17-8-9-18(24-17)25(22,23)21-19-15-6-7-16(19)12-14(11-15)10-13-4-2-1-3-5-13/h1-5,8-10,15-16,19,21H,6-7,11-12H2/b14-10- |
| InChIKey | BYBOSASDIDKAOS-UVTDQMKNSA-N |
| XLogP | 4.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |