C11H16ClNO2S2 — CID 115881167
5-chloro-N-(3,3-dimethylcyclopentyl)thiophene-2-sulfonamide (PubChem CID 115881167) has the molecular formula C11H16ClNO2S2 and a molecular weight of 293.84 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethylcyclopentyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3,3-dimethylcyclopentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115881167 |
| Molecular Formula | C11H16ClNO2S2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 5-chloro-N-(3,3-dimethylcyclopentyl)thiophene-2-sulfonamide |
| SMILES | CC1(C)CCC(NS(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C11H16ClNO2S2/c1-11(2)6-5-8(7-11)13-17(14,15)10-4-3-9(12)16-10/h3-4,8,13H,5-7H2,1-2H3 |
| InChIKey | SQBCDOFWPVQTMY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |