C15H22N2O2S2 — CID 106268895
5-cyano-N-(3,3,5,5-tetramethylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 106268895) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 5-cyano-N-(3,3,5,5-tetramethylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(3,3,5,5-tetramethylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268895 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5-cyano-N-(3,3,5,5-tetramethylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2ccc(C#N)s2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-14(2)7-11(8-15(3,4)10-14)17-21(18,19)13-6-5-12(9-16)20-13/h5-6,11,17H,7-8,10H2,1-4H3 |
| InChIKey | XQNDKIJZWOKKFF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |