About 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide
5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide (PubChem CID 106267400) has the molecular formula C10H12N2O4S3
and a molecular weight of 320.42 g/mol. Its IUPAC name is 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide |
| PubChem CID | 106267400 |
| Molecular Formula | C10H12N2O4S3 |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H12N2O4S3/c11-7-9-1-2-10(17-9)19(15,16)12-8-3-5-18(13,14)6-4-8/h1-2,8,12H,3-6H2 |
| InChIKey | GMLZXTZWLIDYKP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide (CID 106267400) is 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide is N#Cc1ccc(S(=O)(=O)NC2CCS(=O)(=O)CC2)s1.
What is the InChIKey of 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide?
The InChIKey is GMLZXTZWLIDYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S3/c11-7-9-1-2-10(17-9)19(15,16)12-8-3-5-18(13,14)6-4-8/h1-2,8,12H,3-6H2.
What are the key properties of 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide?
5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide has a molecular weight of 320.42 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 106267400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).