C10H16N2O4S3 — CID 43615493
5-(aminomethyl)-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide (PubChem CID 43615493) has the molecular formula C10H16N2O4S3 and a molecular weight of 324.45 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43615493 |
| Molecular Formula | C10H16N2O4S3 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-(aminomethyl)-N-(1,1-dioxothian-4-yl)thiophene-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NC2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H16N2O4S3/c11-7-9-1-2-10(17-9)19(15,16)12-8-3-5-18(13,14)6-4-8/h1-2,8,12H,3-7,11H2 |
| InChIKey | ODDGFAHYSDOWAQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |