C10H16N2O3S2 — CID 43610440
5-(aminomethyl)-N-(oxan-4-yl)thiophene-2-sulfonamide (PubChem CID 43610440) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(oxan-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(oxan-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43610440 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-(aminomethyl)-N-(oxan-4-yl)thiophene-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NC2CCOCC2)s1 |
| InChI | InChI=1S/C10H16N2O3S2/c11-7-9-1-2-10(16-9)17(13,14)12-8-3-5-15-6-4-8/h1-2,8,12H,3-7,11H2 |
| InChIKey | NVBRUZFRQQJOSH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |