C10H15NO3S2 — CID 110726893
5-methyl-N-(oxan-4-yl)thiophene-2-sulfonamide (PubChem CID 110726893) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(oxan-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110726893 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCOCC2)s1 |
| InChI | InChI=1S/C10H15NO3S2/c1-8-2-3-10(15-8)16(12,13)11-9-4-6-14-7-5-9/h2-3,9,11H,4-7H2,1H3 |
| InChIKey | XVZUJMYROFHCAE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |