C10H15NO2S2 — CID 39792230
N-cyclopentyl-5-methylthiophene-2-sulfonamide (PubChem CID 39792230) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-cyclopentyl-5-methylthiophene-2-sulfonamide.
| Compound Name | N-cyclopentyl-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39792230 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N-cyclopentyl-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCC2)s1 |
| InChI | InChI=1S/C10H15NO2S2/c1-8-6-7-10(14-8)15(12,13)11-9-4-2-3-5-9/h6-7,9,11H,2-5H2,1H3 |
| InChIKey | WCZQRDVBZNJFLM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |