C11H16BrNO2S2 — CID 114295850
N-(4-bromocyclohexyl)-5-methylthiophene-2-sulfonamide (PubChem CID 114295850) has the molecular formula C11H16BrNO2S2 and a molecular weight of 338.29 g/mol. Its IUPAC name is N-(4-bromocyclohexyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(4-bromocyclohexyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114295850 |
| Molecular Formula | C11H16BrNO2S2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | N-(4-bromocyclohexyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCC(Br)CC2)s1 |
| InChI | InChI=1S/C11H16BrNO2S2/c1-8-2-7-11(16-8)17(14,15)13-10-5-3-9(12)4-6-10/h2,7,9-10,13H,3-6H2,1H3 |
| InChIKey | DJEAHUVECHTXLC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|