C11H16N2O3S2 — CID 110871416
N-(1-acetylpyrrolidin-3-yl)-5-methylthiophene-2-sulfonamide (PubChem CID 110871416) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(1-acetylpyrrolidin-3-yl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(1-acetylpyrrolidin-3-yl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110871416 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(1-acetylpyrrolidin-3-yl)-5-methylthiophene-2-sulfonamide |
| SMILES | CC(=O)N1CCC(NS(=O)(=O)c2ccc(C)s2)C1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-8-3-4-11(17-8)18(15,16)12-10-5-6-13(7-10)9(2)14/h3-4,10,12H,5-7H2,1-2H3 |
| InChIKey | KYGOMSWLRVMWLQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |