C13H20N2O4S2 — CID 86841914
methyl 4-[(5-ethylthiophen-2-yl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 86841914) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is methyl 4-[(5-ethylthiophen-2-yl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(5-ethylthiophen-2-yl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86841914 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 4-[(5-ethylthiophen-2-yl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCc1ccc(S(=O)(=O)NC2CCN(C(=O)OC)CC2)s1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-3-11-4-5-12(20-11)21(17,18)14-10-6-8-15(9-7-10)13(16)19-2/h4-5,10,14H,3,6-9H2,1-2H3 |
| InChIKey | DUDBTMUSICEOJY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |