C18H27N3O5S2 — CID 33170749
ethyl 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 33170749) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 33170749 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)N2CCC(NS(=O)(=O)c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-2-26-18(23)21-9-5-14(6-10-21)17(22)20-11-7-15(8-12-20)19-28(24,25)16-4-3-13-27-16/h3-4,13-15,19H,2,5-12H2,1H3 |
| InChIKey | FCPAFZFIDAXNQI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |