C13H21N3O3S2 — CID 110822400
N-propan-2-yl-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 110822400) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-propan-2-yl-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-propan-2-yl-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110822400 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-propan-2-yl-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H21N3O3S2/c1-10(2)14-13(17)16-7-5-11(6-8-16)15-21(18,19)12-4-3-9-20-12/h3-4,9-11,15H,5-8H2,1-2H3,(H,14,17) |
| InChIKey | ITONXCSGAHIKQT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |