C16H18FN3O3S2 — CID 55484909
N-(2-fluorophenyl)-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 55484909) has the molecular formula C16H18FN3O3S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 55484909 |
| Molecular Formula | C16H18FN3O3S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(2-fluorophenyl)-4-(thiophen-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H18FN3O3S2/c17-13-4-1-2-5-14(13)18-16(21)20-9-7-12(8-10-20)19-25(22,23)15-6-3-11-24-15/h1-6,11-12,19H,7-10H2,(H,18,21) |
| InChIKey | RMHMGGSUNBPMGU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |