C15H16F2N2O4S3 — CID 46558306
N-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 46558306) has the molecular formula C15H16F2N2O4S3 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46558306 |
| Molecular Formula | C15H16F2N2O4S3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(S(=O)(=O)c2c(F)cccc2F)CC1)c1cccs1 |
| InChI | InChI=1S/C15H16F2N2O4S3/c16-12-3-1-4-13(17)15(12)26(22,23)19-8-6-11(7-9-19)18-25(20,21)14-5-2-10-24-14/h1-5,10-11,18H,6-9H2 |
| InChIKey | MOAWSSBJVNEKGD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |