C17H19FN2O4S2 — CID 136550194
2-(4-fluorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetic acid (PubChem CID 136550194) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetic acid.
| Compound Name | 2-(4-fluorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 136550194 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H19FN2O4S2/c18-13-5-3-12(4-6-13)16(17(21)22)20-9-7-14(8-10-20)19-26(23,24)15-2-1-11-25-15/h1-6,11,14,16,19H,7-10H2,(H,21,22) |
| InChIKey | TZSDUCBJUQBWLE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |