C16H23FN2O4S — CID 136550246
2-(4-fluorophenyl)-2-[4-(propylsulfonylamino)piperidin-1-yl]acetic acid (PubChem CID 136550246) has the molecular formula C16H23FN2O4S and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[4-(propylsulfonylamino)piperidin-1-yl]acetic acid.
| Compound Name | 2-(4-fluorophenyl)-2-[4-(propylsulfonylamino)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 136550246 |
| Molecular Formula | C16H23FN2O4S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[4-(propylsulfonylamino)piperidin-1-yl]acetic acid |
| SMILES | CCCS(=O)(=O)NC1CCN(C(C(=O)O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O4S/c1-2-11-24(22,23)18-14-7-9-19(10-8-14)15(16(20)21)12-3-5-13(17)6-4-12/h3-6,14-15,18H,2,7-11H2,1H3,(H,20,21) |
| InChIKey | XCGVATKTIGRNPQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |