C13H17FN2O2 — CID 54890531
2-(1,4-diazepan-1-yl)-2-(4-fluorophenyl)acetic acid (PubChem CID 54890531) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(4-fluorophenyl)acetic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(4-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 54890531 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(4-fluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C13H17FN2O2/c14-11-4-2-10(3-5-11)12(13(17)18)16-8-1-6-15-7-9-16/h2-5,12,15H,1,6-9H2,(H,17,18) |
| InChIKey | NIXKGMDZXSUIQZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |