C13H16BrFN2O2 — CID 54890387
2-(5-bromo-2-fluorophenyl)-2-(1,4-diazepan-1-yl)acetic acid (PubChem CID 54890387) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-2-(1,4-diazepan-1-yl)acetic acid.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-2-(1,4-diazepan-1-yl)acetic acid |
|---|---|
| PubChem CID | 54890387 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-2-(1,4-diazepan-1-yl)acetic acid |
| SMILES | O=C(O)C(c1cc(Br)ccc1F)N1CCCNCC1 |
| InChI | InChI=1S/C13H16BrFN2O2/c14-9-2-3-11(15)10(8-9)12(13(18)19)17-6-1-4-16-5-7-17/h2-3,8,12,16H,1,4-7H2,(H,18,19) |
| InChIKey | IHZSKXQRFUBMDS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |